Registration Dossier

Diss Factsheets

Reference substances

Reference substances

IUPAC name:
3a,4,5,6,7,7a-hexahydro-5-methoxy-4,7-methano-1H-indene

Inventory

EC number:
258-296-4
EC name:
3a,4,5,6,7,7a-hexahydro-5-methoxy-4,7-methano-1H-indene
CAS number:
53018-24-9
CAS number:
53018-24-9
Synonyms
Names:
Identifier:
common name
Hexahydromethoxy-Methanoindene
3a,4,5,6,7,7a-Hexahydro-5-methoxy-4,7-methano-1H-indene

Molecular and structural information

Molecular formula:
C11H16O
Molecular weight:
164.25
SMILES notation:
O(C(C(C(C(C12)CC=3)C3)C1)C2)C
Structural formula:
Chemical structure

Related substances