Registration Dossier

Diss Factsheets

Reference substances

Reference substances

Currently viewing:
IUPAC name:
[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] 3,4,5-trihydroxybenzoate

Inventory

CAS number:
58511-73-2
Synonyms
Names:
Identifier:
EC number
EC number 611-686-1

Molecular and structural information

Molecular formula:
C13H16O10
Molecular weight:
>= 332.261 - <= 332.261
SMILES notation:
C1=C(C=C(C(=C1O)O)O)C(=O)OC2C(C(C(C(O2)CO)O)O)O
InChl:
InChI = 1S/C13H16O10/c14-3-7-9(18)10(19)11(20)13(22-7)23-12(21)4-1-5(15)8(17)6(16)2-4/h1-2,7,9-11,13-20H,3H2/t7-,9-,10+,11-,13+/m1/s1
Structural formula:
Chemical structure

Related substances