Registration Dossier

Diss Factsheets

Reference substances

Reference substances

Currently viewing:
IUPAC name:
2-hexyldecanoic acid

Inventory

EC number:
246-885-9
EC name:
2-hexyldecanoic acid
CAS number:
25354-97-6
CAS number:
25354-97-6
Synonyms
Names:
2-hexyldecanoic_acid
Decanoic acid, 2-hexyl-
2-hexyldecanoic acid

Molecular and structural information

Molecular formula:
C16H32O2
Molecular weight:
256.424
SMILES notation:
CCCCCCCCC(CCCCCC)C(=O)O
InChl:
InChI=1/C16H32O2/c1-3-5-7-9-10-12-14-15(16(17)18)13-11-8-6-4-2/h15H,3-14H2,1-2H3,(H,17,18)
Structural formula:
Chemical structure

Related substances