Registration Dossier

Diss Factsheets

Reference substances

Reference substances

IUPAC name:
3-fluoro-4-methoxybenzaldehyde

Inventory

EC number:
206-514-3
EC name:
3-fluoro-p-anisaldehyde
CAS number:
351-54-2
CAS number:
351-54-2
Synonyms
Names:
3-fluoro-4-methoxybenzaldehyde

Molecular and structural information

Molecular formula:
C8H7FO2
Molecular weight:
>= 154.14 - <= 154.14
SMILES notation:
COC1=C(C=C(C=C1)C=O)F
InChl:
InChI=1S/C8H7FO2/c1-11-8-3-2-6(5-10)4-7(8)9/h2-5H,1H3
Structural formula:
Chemical structure

Related substances