Registration Dossier

Diss Factsheets

Reference substances

Reference substances

Currently viewing:
IUPAC name:
16-hydroxyhexadec-9-enoic acid

Inventory

EC number:
241-309-2
EC name:
16-hydroxyhexadec-9-enoic acid
CAS number:
17278-80-7
CAS number:
17278-80-7

Synonyms

Molecular and structural information

Molecular formula:
C16H30O3
Molecular weight:
ca. 270.5
SMILES notation:
C(CCCC=CCCCCCCO)CCCC(=O)O
Structural formula:
Chemical structure

Related substances