Registration Dossier

Diss Factsheets

Reference substances

Reference substances

IUPAC name:
2,6-bis[[bis(2-hydroxyethyl)amino]methyl]-4-nonylphenol

Inventory

EC number:
243-500-6
EC name:
2,6-bis[[bis(2-hydroxyethyl)amino]methyl]-4-nonylphenol
CAS number:
20073-51-2
CAS number:
20073-51-2
Synonyms
Names:
2,6-bis[[bis(2-hydroxyethyl)amino]methyl]-4-nonylphenol
Phenol, 2,6-bis[[bis(2-hydroxyethyl)amino]methyl]-4-nonyl-
2,6-bis{[bis(2-hydroxyethyl)amino]methyl}-4-nonylphenol

Molecular and structural information

Molecular formula:
C25H46N2O5
Molecular weight:
454.643
SMILES notation:
CCCCCCCCCc1cc(CN(CCO)CCO)c(O)c(CN(CCO)CCO)c1
InChl:
InChI=1/C25H46N2O5/c1-2-3-4-5-6-7-8-9-22-18-23(20-26(10-14-28)11-15-29)25(32)24(19-22)21-27(12-16-30)13-17-31/h18-19,28-32H,2-17,20-21H2,1H3
Structural formula:
Chemical structure

Related substances