Registration Dossier

Diss Factsheets

Reference substances

Reference substances

IUPAC name:
anthracene-9-carboxylic acid

Inventory

EC number:
211-964-9
EC name:
Anthracene-9-carboxylic acid
CAS number:
723-62-6
CAS number:
723-62-6
Synonyms
Names:
9-Anthracenecarboxylic acid
anthracene-9-carboxylic acid

Molecular and structural information

Molecular formula:
C15H10O2
Molecular weight:
222.239
SMILES notation:
OC(=O)c1c2ccccc2cc3ccccc13
InChl:
InChI=1/C15H10O2/c16-15(17)14-12-7-3-1-5-10(12)9-11-6-2-4-8-13(11)14/h1-9H,(H,16,17)
Structural formula:
Chemical structure

Related substances

Categories Display