Registration Dossier

Diss Factsheets

Reference substances

Reference substances

IUPAC name:
5,7-diazaspiro[3.4]octane-6,8-dione

Inventory

CAS number:
89691-88-3
Synonyms
Names:
1,1-Cyclobutane-5-spiro-hydantoine
5,7-diazaspiro[3.4]octane-6,8-dione

Molecular and structural information

Molecular formula:
C6H8N2O2
Molecular weight:
140.14
SMILES notation:
O=C1NC(NC12CCC2)=O
InChl:
InChI=1S/C6H8N2O2/c9-4-6(2-1-3-6)8-5(10)7-4/h1-3H2,(H2,7,8,9,10)
Structural formula:
Chemical structure

Related substances