Registration Dossier

IUPAC name:
3-carboxy-2-hydroxy-N,N,N-trimethylpropan-1-aminium hydroxide

Inventory

EC number:
208-768-0
EC name:
(R)-(3-carboxy-2-hydroxypropyl)trimethylammonium hydroxide
CAS number:
541-15-1
CAS number:
541-15-1

Synonyms

Molecular and structural information

Molecular formula:
C7H15NO3
Molecular weight:
179.214
SMILES notation:
[OH-].C[N+](C)(C)C[C@H](O)CC(=O)O
InChl:
InChI=1/C7H15NO3.H2O/c1-8(2,3)5-6(9)4-7(10)11;/h6,9H,4-5H2,1-3H3;1H2
Structural formula:
Chemical structure

Related substances