Registration Dossier

IUPAC name:
(11-oxo-6,11-dihydro-dibenzo[b,e]oxepin-2-yl)-acetic acid butyl ester

Inventory

CAS number:
60548-14-3

Synonyms

Molecular and structural information

Molecular formula:
C20H20O4
Molecular weight:
324.38
SMILES notation:
CCCCOC(=O)Cc1ccc2OCc3ccccc3C(=O)c2c1
Structural formula:
Chemical structure

Related substances