Registration Dossier

IUPAC name:
(2R,3R)-3-(3-(Benzyloxy)phenyl-2-methylpentanoic acid

Inventory

CAS number:
1367878-84-9

Synonyms

Molecular and structural information

Molecular formula:
C19 H22 O3
Molecular weight:
298.38
SMILES notation:
O=C(O)[C@H](C)[C@@H](CC)C1=CC=CC(OCC2=CC=CC=C2)=C1
InChl:
InChI=1S/C19H22O3/c1-3-18(14(2)19(20)21)16-10-7-11-17(12-16)22-13-15-8-5-4-6-9-15/h4-12,14,18H,3,13H2,1-2H3,(H,20,21)/t14-,18-/m1/s1
Structural formula:
Chemical structure

Related substances