Registration Dossier

Diss Factsheets

Reference substances

Reference substances

IUPAC name:
5-methyl-4H,5H,6H,7H-[1,3]thiazolo[5,4-c]pyridine-2-carboxylic acid hydrochloride

Inventory

CAS number:
720720-96-7
Synonyms
Names:
5-methyl-4,5,6,7-tetrahydro[1,3]thiazolo[5,4-c]pyridine-2-carboxylic acid hydrochloride

Molecular and structural information

Molecular formula:
C8H11ClN2O2S
Molecular weight:
ca. 234.7
SMILES notation:
Cl.O=C(O)c1nc2CCN(C)Cc2s1
Structural formula:
Chemical structure

Related substances