Registration Dossier

Reference substances

Reference substances

IUPAC name:
1,2-dichloro-4-(trichloromethyl)benzene

Inventory

EC number:
235-869-7
EC name:
1,2-dichloro-4-(trichloromethyl)benzene
CAS number:
13014-24-9
CAS number:
13014-24-9
Synonyms
Names:
3,4-DCBTC
3,4-dichlorobenzotrichloride
1,2-dichloro-4-(trichloromethyl)benzene

Molecular and structural information

Molecular formula:
C7H3Cl5
Molecular weight:
264.36
SMILES notation:
Clc1ccc(cc1Cl)C(Cl)(Cl)Cl
Structural formula:
Chemical structure

Related substances