Registration Dossier

Diss Factsheets

IUPAC name:
methyl 5-(4-bromo-2-fluoroanilino)-4-fluoro-1-methyl-1H-benzimidazole-6-carboxylate

Inventory

CAS number:
1415559-93-1

Synonyms

Molecular and structural information

Molecular formula:
C16H12BrF2N3O2
Molecular weight:
396.186
SMILES notation:
Brc3ccc(Nc1c(F)c2ncn(C)c2cc1C(=O)OC)c(F)c3
InChl:
InChI=1S/C16H12BrF2N3O2/c1-22-7-20-15-12(22)6-9(16(23)24-2)14(13(15)19)21-11-4-3-8(17)5-10(11)18/h3-7,21H,1-2H3
Structural formula:
Chemical structure

Related substances

Identifier:
CAS number
Identity:
1604812-69-2