Registration Dossier

Diss Factsheets

Reference substances

Reference substances

IUPAC name:
2-(cyclopropylmethoxy)acetic acid

Inventory

CAS number:
246869-08-9
Synonyms
Names:
(cyclopropylmethoxy)acetic acid

Molecular and structural information

Molecular formula:
C6H10O3
Molecular weight:
130.14
SMILES notation:
O=C(O)COCC1CC1
InChl:
InChI=1S/C6H10O3/c7-6(8)4-9-3-5-1-2-5/h5H,1-4H2,(H,7,8)
Structural formula:
Chemical structure

Related substances