Registration Dossier

Diss Factsheets

IUPAC name:
4-amino-3-(4-phenoxyphenyl)-1-[(3R)-piperidin-3-yl]-1,3-dihydro-2H-imidazo[4,5-c]pyridin-2-one

Inventory

CAS number:
1971921-35-3

Synonyms

Molecular and structural information

Molecular formula:
C23H23N5O2
Molecular weight:
ca. 401
SMILES notation:
c1ccc(cc1)Oc2ccc(cc2)n3c4c(ccnc4N)n(c3=O)[C@@H]5CCCNC5
Structural formula:
Chemical structure

Related substances