Registration Dossier

Diss Factsheets

Reference substances

Reference substances

IUPAC name:
choline hydrogen carbonate

Inventory

EC number:
201-137-0
EC name:
Choline hydrogen carbonate
CAS number:
78-73-9
CAS number:
78-73-9
Synonyms
Names:
hydrogen (2-hydroxyethyl)trimethylazanium carbonate

Molecular and structural information

Molecular formula:
C5H14NO.CHO3
Molecular weight:
ca. 165.19
SMILES notation:
OC([O-])=O.C[N+](C)(C)CCO
InChl:
InChI=1/C5H14NO.CH2O3/c1-6(2,3)4-5-7;2-1(3)4/h7H,4-5H2,1-3H3;(H2,2,3,4)/q+1;/p-1
Structural formula:
Chemical structure

Related substances