Registration Dossier

Diss Factsheets

IUPAC name:
(7S,9aS)-7-[(benzyloxy)methyl]octahydropyrazino[2,1-c][1,4]oxazine dioxalic acid salt

Inventory

CAS number:
1268364-46-0

Synonyms

Molecular and structural information

Molecular formula:
C15H22N2O2.2C2H2O4
Molecular weight:
442.42
SMILES notation:
OC(=O)C(=O)O.OC(=O)C(=O)O.C(OCc1ccccc1)[C@@H]2CN3CCOC[C@@H]3CN2
InChl:
InChI=1S/C15H22N2O2.2C2H2O4/c1-2-4-13(5-3-1)10-19-11-14-9-17-6-7-18-12-15(17)8-16-14;2*3-1(4)2(5)6/h1-5,14-16H,6-12H2;2*(H,3,4)(H,5,6)/t14-,15-;;/m0../s1
Structural formula:
Chemical structure

Related substances