Registration Dossier

Diss Factsheets

IUPAC name:
trans-2-(4-Bromophenyl)-5-propyltetrahydro-2H-pyran

Inventory

CAS number:
700863-30-5

Synonyms

Molecular and structural information

Molecular formula:
C₁₄H₁₉BrO
Molecular weight:
28 320
SMILES notation:
BrC1=CC=C(C=C1)C2OCC(CCC)CC2
InChl:
InChI=1/C14H19BrO/c1-2-3-11-4-9-14(16-10-11)12-5-7-13(15)8-6-12/h5-8,11,14H,2-4,9-10H2,1H3/t11-,14+/s2
Structural formula:
Chemical structure

Related substances