Registration Dossier

Diss Factsheets

IUPAC name:
1,3-bis(3-(1H-imidazol-1-yl)propyl)urea

Inventory

CAS number:
1807618-04-7

Synonyms

Molecular and structural information

Molecular formula:
C13H20N6O
Molecular weight:
ca. 276.34
SMILES notation:
O=C(NCCCn1ccnc1)NCCCn1ccnc1
Structural formula:
Chemical structure

Related substances