Registration Dossier

Diss Factsheets

Reference substances

Reference substances

Currently viewing:
IUPAC name:
2-{2-[4-(2-{4-[2-(prop-2-enoyloxy)ethoxy]phenyl}propan-2-yl)phenoxy]ethoxy}ethyl prop-2-enoate

Inventory

Synonyms

Molecular and structural information

Molecular formula:
C27 H32 O7
Molecular weight:
468.539
SMILES notation:
c1cc(ccc1OCCOC(=O)C=C)C(c2ccc(cc2)OCCOCCOC(C=C)=O)(C)C
Structural formula:
Chemical structure

Related substances