Registration Dossier

Diss Factsheets

Reference substances

Reference substances

Currently viewing:
IUPAC name:
3,5-dichlorobenzoyl chloride

Inventory

EC number:
220-813-6
EC name:
3,5-dichlorobenzoyl chloride
CAS number:
2905-62-6
CAS number:
2905-62-6
Synonyms
Names:
Benzoyl chloride, 3,5-dichloro-
3,5-dichlorobenzoyl chloride

Molecular and structural information

Molecular formula:
C7H3Cl3O
Molecular weight:
ca. 209.46
SMILES notation:
ClC(=O)c1cc(Cl)cc(Cl)c1
InChl:
InChI=1/C7H3Cl3O/c8-5-1-4(7(10)11)2-6(9)3-5/h1-3H
Structural formula:
Chemical structure

Related substances