Registration Dossier

Diss Factsheets

Reference substances

Reference substances

IUPAC name:
3-(3-tert-butyl-4-hydroxyphenyl)propanoic acid

Inventory

EC number:
403-920-4
EC name:
3-(3-tert-butyl-4-hydroxyphenyl)propionic acid
CAS number:
-
Description:
G 19-675 ZP
CAS number:
107551-67-7
Synonyms
Names:
G19-675ZP
3-(3-tert-butyl-4-hydroxyphenyl)propionic acid

Molecular and structural information

Molecular formula:
C13H18O3
Molecular weight:
222.3
SMILES notation:
CC(C)(C)c1cc(ccc1O)CCC(=O)O
Structural formula:
Chemical structure

Related substances