Registration Dossier

IUPAC name:
trans-1,4-bis(iodomethyl)cyclohexane

Inventory

CAS number:
83447-96-5

Synonyms

Molecular and structural information

Molecular formula:
C8H14I2
Molecular weight:
364.01
SMILES notation:
IC[C@H]1CC[C@H](CI)CC1
InChl:
InChI=1S/C8H14I2/c9-5-7-1-2-8(6-10)4-3-7/h7-8H,1-6H2/t7-,8-
Structural formula:
Chemical structure

Related substances

Identifier:
CAS number
Identity:
35541-76-5