Registration Dossier

Diss Factsheets

Reference substances

Reference substances

IUPAC name:
bis(triphenylphosphine)nickel(II) chloride

Inventory

EC number:
238-154-8
EC name:
Bis(triphenylphosphine)nickel(II) chloride
CAS number:
14264-16-5
CAS number:
14264-16-5
Synonyms
Names:
bis(triphenylphosphine)nickel(II) chloride

Molecular and structural information

Molecular formula:
C36H30Cl2NiP2
Molecular weight:
ca. 654
SMILES notation:
Cl[Ni](Cl)([P+](C1CCCCC1)(C2CCCCC2)C3CCCCC3)[P+](C4CCCCC4)(C5CCCCC5)C6CCCCC6
Structural formula:
Chemical structure

Related substances