Registration Dossier

Diss Factsheets

Reference substances

Reference substances

IUPAC name:
benzoyl chloride

Inventory

EC number:
202-710-8
EC name:
Benzoyl chloride
CAS number:
98-88-4
CAS number:
98-88-4
Synonyms
Names:
Benzoyl chloride
benzoyl chloride

Molecular and structural information

Molecular formula:
C7H5ClO
Molecular weight:
140.567
SMILES notation:
ClC(=O)c1ccccc1
InChl:
InChI=1/C7H5ClO/c8-7(9)6-4-2-1-3-5-6/h1-5H
Structural formula:
Chemical structure

Related substances