Registration Dossier

Diss Factsheets

Reference substances

Reference substances

Currently viewing:
IUPAC name:
ammonium oleate

Inventory

EC number:
208-873-1
EC name:
Ammonium oleate
CAS number:
544-60-5
CAS number:
544-60-5
Synonyms
Names:
9-Octadecenoic acid (9Z)-, ammonium salt
9-Octadecenoic acid (Z)-, ammonium salt
ammonium octadec-9-enoate

Molecular and structural information

Molecular formula:
C18H34O2.H3N
Molecular weight:
299.492
SMILES notation:
[NH4+].CCCCCCCC\C=C/CCCCCCCC(=O)[O-]
InChl:
InChI=1/C18H34O2.H3N/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;/h9-10H,2-8,11-17H2,1H3,(H,19,20);1H3
Structural formula:
Chemical structure

Related substances