Registration Dossier

Diss Factsheets

Reference substances

Reference substances

Currently viewing:
IUPAC name:
2-(2-phenylethyl)benzoic acid

Inventory

EC number:
225-511-8
EC name:
o-phenethylbenzoic acid
CAS number:
4890-85-1
CAS number:
4890-85-1
Synonyms
Names:
2-(2-phenylethyl)benzoic acid

Molecular and structural information

Molecular formula:
C15H14O2
Molecular weight:
226.27
SMILES notation:
C1=CC=C(C=C1)CCC2=CC=CC=C2C(=O)O
InChl:
InChI=1S/C15H14O2/c16-15(17)14-9-5-4-8-13(14)11-10-12-6-2-1-3-7-12/h1-9H,10-11H2,(H,16,17)
Structural formula:
Chemical structure

Related substances

Categories Display