Registration Dossier

Diss Factsheets

IUPAC name:
4-amino-N-[3-(diethylamino)propyl]benzamide

Inventory

CAS number:
106595-73-7

Synonyms

Molecular and structural information

Molecular formula:
C14H23N3O
Molecular weight:
ca. 249.36
SMILES notation:
CCN(CC)CCCNC(=O)c1ccc(N)cc1
Structural formula:
Chemical structure

Related substances