Registration Dossier

Diss Factsheets

Reference substances

Reference substances

Currently viewing:
IUPAC name:
methyl abietate

Inventory

EC number:
204-832-7
EC name:
Methyl abietate
CAS number:
127-25-3
CAS number:
127-25-3
Synonyms
Names:
Identifier:
common name
Methyl abietate
methyl (1R,4aR,4bR,10aR)-1,4a-dimethyl-7-(propan-2-yl)-1,2,3,4,4a,4b,5,6,10,10a-decahydrophenanthrene-1-carboxylate

Molecular and structural information

Molecular formula:
C21H32O2
Molecular weight:
316.482
SMILES notation:
COC(=O)[C@]1(C)CCC[C@]2(C)[C@H]3CCC(=CC3=CC[C@@H]12)C(C)C
InChl:
1S/C21H32O2/c1-14(2)15-7-9-17-16(13-15)8-10-18-20(17,3)11-6-12-21(18,4)19(22)23-5/h8,13-14,17-18H,6-7,9-12H2,1-5H3/t17-,18+,20+,21+/m0/s1
Structural formula:
Chemical structure

Related substances