Registration Dossier

Diss Factsheets

Reference substances

Reference substances

IUPAC name:
N,N-dimethylcarbamoyl chloride

Inventory

EC number:
201-208-6
EC name:
Dimethylcarbamoyl chloride
CAS number:
79-44-7
CAS number:
79-44-7
Synonyms
Names:
Carbamic chloride, dimethyl-
DMCC
dimethylcarbamic chloride

Molecular and structural information

Molecular formula:
C3H6ClNO
Molecular weight:
107.539
SMILES notation:
CN(C)C(=O)Cl
InChl:
InChI=1/C3H6ClNO/c1-5(2)3(4)6/h1-2H3
Structural formula:
Chemical structure

Related substances