Registration Dossier

IUPAC name:
trans,trans-4-((Z)-Propen-1-yl)-4'-propyl-bicyclohexan

Inventory

Synonyms

Molecular and structural information

Molecular formula:
C18H32
Molecular weight:
248.46
SMILES notation:
[H][C@@]1(CC[C@H](CCC)CC1)[C@@]1([H])CC[C@@H](CC1)\C=C/C
InChl:
InChI=1/C18H32/c1-3-5-15-7-11-17(12-8-15)18-13-9-16(6-4-2)10-14-18/h3,5,15-18H,4,6-14H2,1-2H3/b5-3-/t15-,16-,17-,18-
Structural formula:
Chemical structure

Related substances