Registration Dossier

IUPAC name:
2-[(1,3-dihydro-1,3-dioxo-2H-isoindol-2-yl)methyl]-N,N-diethyl-1-phenyl-

Inventory

Synonyms

Molecular and structural information

Molecular formula:
C23H24N2O3
Molecular weight:
376.45
SMILES notation:
C1C=C(C=CC=1)C(C1)(C1CN(C(=O)C1C=C2)C(=O)C=1C=C2)C(N(CC)CC)=O
InChl:
InChI=1S/C23H24N2O3/c1-3-24(4-2)22(28)23(16-10-6-5-7-11-16)14-17(23)15-25-20(26)18-12-8-9-13-19(18)21(25)27/h5-13,17H,3-4,14-15H2,1-2H3
Structural formula:
Chemical structure

Related substances