Registration Dossier

Diss Factsheets

IUPAC name:
rel-(3aR,4R,7S,7aR)-3a,4,5,6,7,7a-hexahydro-1H-4,7-methanoindene

Inventory

CAS number:
3129-29-1

Synonyms

Molecular and structural information

Molecular formula:
C10H24
Molecular weight:
134.22
SMILES notation:
C=1C[C@@H]2[C@H]3CC[C@H](C3)[C@@H]2C=1
InChl:
InChI=1S/C10H14/c1-2-9-7-4-5-8(6-7)10(9)3-1/h1-2,7-10H,3-6H2/t7-,8+,9+,10-/m1/s1
Structural formula:
Chemical structure

Related substances

Identifier:
CAS number
Identity:
4488-57-7

Categories Display