Registration Dossier

Diss Factsheets

Reference substances

Reference substances

IUPAC name:
chloroacetic acid

Inventory

EC number:
201-178-4
EC name:
Chloroacetic acid
CAS number:
79-11-8
CAS number:
79-11-8
Synonyms
Names:
Acetic acid, chloro-
acetyl chloride

Molecular and structural information

Molecular formula:
C2H3ClO2
Molecular weight:
78.498
SMILES notation:
CC(Cl)=O
InChl:
InChI=1/C2H3ClO/c1-2(3)4/h1H3
Structural formula:
Chemical structure

Related substances

Categories Display