Registration Dossier

Diss Factsheets

Reference substances

Reference substances

IUPAC name:
4-hydrazinylbenzoic acid

Inventory

EC number:
210-609-5
EC name:
4-hydrazinobenzoic acid
CAS number:
619-67-0
CAS number:
619-67-0
Synonyms
Names:
Benzoic acid, 4-hydrazino-
4-hydrazinobenzoic acid

Molecular and structural information

Molecular formula:
C7H8N2O2
Molecular weight:
152.151
SMILES notation:
NNc1ccc(cc1)C(=O)O
InChl:
InChI=1/C7H8N2O2/c8-9-6-3-1-5(2-4-6)7(10)11/h1-4,9H,8H2,(H,10,11)
Structural formula:
Chemical structure

Related substances