Registration Dossier

Reference substances

Reference substances

IUPAC name:
phenylacetyl chloride

Inventory

EC number:
203-146-5
EC name:
Phenylacetyl chloride
CAS number:
103-80-0
CAS number:
103-80-0
Synonyms
Names:
Acetyl chloride, phenyl-
Benzeneacetyl chloride
Identifier:
IUPAC name
phenylacetyl chloride
Identifier:
other: SMILES notation
ClC(=O)Cc1ccccc1
Identifier:
other: InChl
InChI=1/C8H7ClO/c9-8(10)6-7-4-2-1-3-5-7/h1-5H,6H2
2-phenylacetyl chloride

Molecular and structural information

Molecular formula:
C8H7ClO
Molecular weight:
>= 154.592 - <= 154.594
SMILES notation:
C1=CC=C(C=C1)CC(=O)Cl
InChl:
InChI=1S/C8H7ClO/c9-8(10)6-7-4-2-1-3-5-7/h1-5H,6H2
Structural formula:
Chemical structure

Related substances