Registration Dossier

Reference substances

Reference substances

Currently viewing:
IUPAC name:
(9E)-N,N,N-trimethyloctadec-9-en-1-aminium chloride

Inventory

Synonyms

Molecular and structural information

Molecular formula:
C21H44ClN
Molecular weight:
346
SMILES notation:
[Cl-].C[N+](C)(C)CCCCCCCC\C=C\CCCCCCCC
Structural formula:
Chemical structure

Related substances