Registration Dossier

Diss Factsheets

Reference substances

Reference substances

IUPAC name:
pyridine-2-carboxylic acid

Inventory

EC number:
202-719-7
EC name:
Pyridine-2-carboxylic acid
CAS number:
98-98-6
CAS number:
98-98-6
Synonyms
Names:
2-Pyridinecarboxylic acid
pyridine-2-carboxylic acid

Molecular and structural information

Molecular formula:
C6H5NO2
Molecular weight:
123.109
SMILES notation:
OC(=O)c1ccccn1
InChl:
InChI=1/C6H5NO2/c8-6(9)5-3-1-2-4-7-5/h1-4H,(H,8,9)
Structural formula:
Chemical structure

Related substances

Categories Display