Registration Dossier

Reference substances

Reference substances

IUPAC name:
2-[(E)-2-(2,4-diamino-6-hydroxypyrimidin-5-yl)diazen-1-yl]-5-methylbenzene-1-sulfonic acid

Inventory

Synonyms
Names:
TKP 50130
2-[(2,4-diamino-6-hydroxypyrimidin-5-yl)diazenyl]-5-methylbenzenesulfonic acid

Molecular and structural information

Molecular formula:
C11H12N6SO4
Molecular weight:
324.32
SMILES notation:
Nc2nc(N)nc(O)c2/N=N/c1ccc(C)cc1S(=O)(=O)O
Structural formula:
Chemical structure

Related substances

Identifier:
CAS number
Identity:
1021701-36-9