Registration Dossier

IUPAC name:
2-isobutyl-4-vinyl-1,3-dioxolane

Inventory

CAS number:
1411949-02-4

Synonyms

Molecular and structural information

Molecular formula:
C9H19O2
Molecular weight:
156.222
SMILES notation:
isomer I: CC(C)C[C@H]1OC[C@H](O1)C=C
isomer II: CC(C)C[C@@H]1OC[C@H](O1)C=C
InChl:
InChI=1/C9H16O2/c1-4-8-6-10-9(11-8)5-7(2)3/h4,7-9H,1,5-6H2,2-3H3
Structural formula:
Chemical structure

Related substances