Registration Dossier

Reference substances

Reference substances

Currently viewing:
IUPAC name:
undec-2-enoic acid

Inventory

EC number:
215-583-9
EC name:
Undecenoic acid
CAS number:
1333-28-4
CAS number:
1333-28-4

Synonyms

Molecular and structural information

Molecular formula:
C11H20O2
Molecular weight:
184.275
SMILES notation:
OC(=O)C=CCCCCCCCC
InChl:
InChI=1/C11H20O2/c1-2-3-4-5-6-7-8-9-10-11(12)13/h9-10H,2-8H2,1H3,(H,12,13)
Structural formula:
Chemical structure

Related substances