Registration Dossier

Diss Factsheets

Reference substances

Reference substances

Currently viewing:
IUPAC name:
Additiv 104 structure 3

Inventory

Synonyms

Molecular and structural information

Molecular formula:
C66H129Mo2N3O9
Molecular weight:
1 300.7
SMILES notation:
O=[Mo](OCCN(CCCCCCCC/C=C/CCCCCCCC)CCO[Mo]1(OCCN2CCCCCCCC/C=C/CCCCCCCC)(OCC2)=O)(OCCN(CCCCCCCC/C=C/CCCCCCCC)CCO1)=O
InChl:
InChI=1S/3C22H43NO2.2Mo.3O/c3*1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-23(19-21-24)20-22-25;;;;;/h3*9-10H,2-8,11-22H2,1H3;;;;;/q3*-2;+2;+4;;;/b3*10-9+;;;;;
Structural formula:
Chemical structure

Related substances