Registration Dossier

Diss Factsheets

Reference substances

Reference substances

IUPAC name:
2-(5-tert-Butyl-2-hydroxyphenyl)benzotriazole

Inventory

EC number:
221-574-0
EC name:
2-(2H-benzotriazol-2-yl)-4-tert-butylphenol
CAS number:
3147-76-0
CAS number:
3147-76-0
Synonyms
Names:
2-(2H-1,2,3-benzotriazol-2-yl)-4-tert-butylphenol

Molecular and structural information

Molecular formula:
C16H17N3O
Molecular weight:
267.33
SMILES notation:
CC(C)(C)C1=CC(N2N=C3C=CC=CC3=N2)=C(O)C=C1
Structural formula:
Chemical structure

Related substances