Registration Dossier

Diss Factsheets

Reference substances

Reference substances

IUPAC name:
4-chlorobenzoic acid

Inventory

EC number:
200-805-9
EC name:
4-chlorobenzoic acid
CAS number:
74-11-3
CAS number:
74-11-3
Synonyms
Names:
Benzoic acid, 4-chloro-
4-chlorobenzoic acid

Molecular and structural information

Molecular formula:
C7H5ClO2
Molecular weight:
156.566
SMILES notation:
OC(=O)c1ccc(Cl)cc1
InChl:
InChI=1/C7H5ClO2/c8-6-3-1-5(2-4-6)7(9)10/h1-4H,(H,9,10)
Structural formula:
Chemical structure

Related substances