Registration Dossier

Reference substances

Reference substances

Currently viewing:
IUPAC name:
2-[bis(carboxymethyl)amino]acetic acid

Inventory

EC number:
205-355-7
EC name:
Nitrilotriacetic acid
CAS number:
139-13-9
CAS number:
139-13-9
Synonyms
Names:
Glycine, N,N-bis(carboxymethyl)-
Identifier:
EC number
205-355-7
2,2',2''-nitrilotriacetic acid

Molecular and structural information

Molecular formula:
C6H9NO6
Molecular weight:
191.139
SMILES notation:
OC(=O)CN(CC(=O)O)CC(=O)O
InChl:
InChI=1/C6H9NO6/c8-4(9)1-7(2-5(10)11)3-6(12)13/h1-3H2,(H,8,9)(H,10,11)(H,12,13)
Structural formula:
Chemical structure

Related substances