Registration Dossier

Reference substances

Reference substances

Currently viewing:
IUPAC name:
2,5-bis(tert-butylperoxy)-2,5-dimethylhexane

Inventory

EC number:
201-128-1
EC name:
Di-tert-butyl 1,1,4,4-tetramethyltetramethylene diperoxide
CAS number:
78-63-7
CAS number:
78-63-7
Synonyms
Names:
Peroxide, (1,1,4,4-tetramethyl-1,4- butanediyl)bis[(1,1-dimethylethyl)
Peroxide, (1,1,4,4-tetramethyl-1,4-butanediyl)bis (1,1-dimethylethyl)
Peroxide, (1,1,4,4-tetramethyl-1,4-butanediyl)bis[(1,1-dimethylethyl)

Molecular and structural information

Molecular formula:
C16H34O4
Molecular weight:
290.439
SMILES notation:
CC(C)(C)OOC(C)(C)CCC(C)(C)OOC(C)(C)C
InChl:
InChI=1/C16H34O4/c1-13(2,3)17-19-15(7,8)11-12-16(9,10)20-18-14(4,5)6/h11-12H2,1-10H3
Structural formula:
Chemical structure

Related substances