Registration Dossier

Diss Factsheets

Reference substances

Reference substances

Currently viewing:
IUPAC name:
2-hydroxy-4-(trifluoromethyl)benzoic acid

Inventory

CAS number:
328-90-5
Synonyms
Names:
4-Trifluoromethyl salicylic acid
IN-ATFMS
TFMSA
Trifluoromethyl salicylic acid
Identifier:
other: SMILES notation
OC(=O)c1ccc(cc1O)C(F)(F)F
2-hydroxy-4-(trifluoromethyl)benzoic acid

Molecular and structural information

Molecular formula:
C8H5F3O3
Molecular weight:
206.119
SMILES notation:
C1=CC(=C(C=C1C(F)(F)F)O)C(=O)O
InChl:
InChI=1/C8H5F3O3/c9-8(10,11)4-1-2-5(7(13)14)6(12)3-4/h1-3,12H,(H,13,14)
Structural formula:
Chemical structure

Related substances

Categories Display