Registration Dossier

Diss Factsheets

Reference substances

Reference substances

IUPAC name:
chloroacetic acid

Inventory

EC number:
201-178-4
EC name:
Chloroacetic acid
CAS number:
79-11-8
CAS number:
79-11-8
Synonyms
Names:
2-chloro-ethanoic acid

Molecular and structural information

Molecular formula:
C2H3ClO2
Molecular weight:
94.5
SMILES notation:
ClCC(O)=O
InChl:
InChI=1S/C2H3ClO2/c3-1-2(4)5/h1H2,(H,4,5)
Structural formula:
Chemical structure

Related substances

Categories Display