Registration Dossier

Diss Factsheets

Reference substances

Reference substances

Currently viewing:
IUPAC name:
Glycerides, mixed C8-10 (even numbered), monosuccinate

Inventory

Synonyms

Molecular and structural information

Molecular formula:
C42H74O12 - C50H90O12
Molecular weight:
>= 772.03 - <= 883.242
SMILES notation:
Some examples for possible structures:
CCCCCCCC(=O)OCC(COC(=O)CCC(=O)OCC(COC(=O)CCCCCCC)OC(=O)CCCCCCC)OC(=O)CCCCCCC
CCCCCCCC(=O)OCC(COC(=O)CCCCCCC)OC(=O)CCC(=O)OC(COC(=O)CCCCCCC)COC(=O)CCCCCCC
CCCCCCCC(=O)OCC(COC(=O)CCC(=O)OC(COC(=O)CCCCCCC)COC(=O)CCCCCCC)OC(=O)CCCCCCC
CCCCCCCCCC(=O)OCC(COC(=O)CCC(=O)OC(COC(=O)CCCCCCCCC)COC(=O)CCCCCCCCC)OC(=O)CCCCCCCCC
CCCCCCCCCC(=O)OCC(COC(=O)CCC(=O)OCC(COC(=O)CCCCCCCCC)OC(=O)CCCCCCCCC)OC(=O)CCCCCCCCC
CCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCC)OC(=O)CCC(=O)OC(COC(=O)CCCCCCCCC)COC(=O)CCCCCCCCC
InChl:
Some examples for possible structures:
InChI=1S/C42H74O12/c1-5-9-13-17-21-25-37(43)49-31-35(53-41(47)27-23-19-15-11-7-3)33-51-39(45)29-30-40(46)52-34-36(54-42(48)28-24-20-16-12-8-4)32-50-38(44)26-22-18-14-10-6-2/h35-36H,5-34H2,1-4H3
InChI=1S/C42H74O12/c1-5-9-13-17-21-25-37(43)49-31-35(32-50-38(44)26-22-18-14-10-6-2)53-41(47)29-30-42(48)54-36(33-51-39(45)27-23-19-15-11-7-3)34-52-40(46)28-24-20-16-12-8-4/h35-36H,5-34H2,1-4H3
InChI=1S/C42H74O12/c1-5-9-13-17-21-25-37(43)49-31-35(53-41(47)28-24-20-16-12-8-4)34-52-40(46)29-30-42(48)54-36(32-50-38(44)26-22-18-14-10-6-2)33-51-39(45)27-23-19-15-11-7-3/h35-36H,5-34H2,1-4H3
InChI=1S/C50H90O12/c1-5-9-13-17-21-25-29-33-45(51)57-39-43(61-49(55)36-32-28-24-20-16-12-8-4)42-60-48(54)37-38-50(56)62-44(40-58-46(52)34-30-26-22-18-14-10-6-2)41-59-47(53)35-31-27-23-19-15-11-7-3/h43-44H,5-42H2,1-4H3
InChI=1S/C50H90O12/c1-5-9-13-17-21-25-29-33-45(51)57-39-43(61-49(55)35-31-27-23-19-15-11-7-3)41-59-47(53)37-38-48(54)60-42-44(62-50(56)36-32-28-24-20-16-12-8-4)40-58-46(52)34-30-26-22-18-14-10-6-2/h43-44H,5-42H2,1-4H3
InChI=1S/C50H90O12/c1-5-9-13-17-21-25-29-33-45(51)57-39-43(40-58-46(52)34-30-26-22-18-14-10-6-2)61-49(55)37-38-50(56)62-44(41-59-47(53)35-31-27-23-19-15-11-7-3)42-60-48(54)36-32-28-24-20-16-12-8-4/h43-44H,5-42H2,1-4H3
Structural formula:
Chemical structure

Related substances